C15H23F3O4 — CID 90080218
(2R,3S)-5-methyl-3-[(2-methylpropan-2-yl)oxycarbonyl]-2-(3,3,3-trifluoropropyl)hex-5-enoic acid (PubChem CID 90080218) has the molecular formula C15H23F3O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is (2R,3S)-5-methyl-3-[(2-methylpropan-2-yl)oxycarbonyl]-2-(3,3,3-trifluoropropyl)hex-5-enoic acid.
| Compound Name | (2R,3S)-5-methyl-3-[(2-methylpropan-2-yl)oxycarbonyl]-2-(3,3,3-trifluoropropyl)hex-5-enoic acid |
|---|---|
| PubChem CID | 90080218 |
| Molecular Formula | C15H23F3O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (2R,3S)-5-methyl-3-[(2-methylpropan-2-yl)oxycarbonyl]-2-(3,3,3-trifluoropropyl)hex-5-enoic acid |
| SMILES | C=C(C)CC(C(=O)OC(C)(C)C)[C@@H](CCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C15H23F3O4/c1-9(2)8-11(13(21)22-14(3,4)5)10(12(19)20)6-7-15(16,17)18/h10-11H,1,6-8H2,2-5H3,(H,19,20)/t10-,11?/m1/s1 |
| InChIKey | SDQJLDLPQLQSRJ-NFJWQWPMSA-N |
| XLogP | 3.95 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|