About 6-[2,5-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]-3-piperazin-1-ylquinoline
6-[2,5-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]-3-piperazin-1-ylquinoline (PubChem CID 90080283) has the molecular formula C23H23F2N4O3S-
and a molecular weight of 473.53 g/mol. Its IUPAC name is 6-[2,5-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]-3-piperazin-1-ylquinoline.
Molecular Properties
| Compound Name | 6-[2,5-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]-3-piperazin-1-ylquinoline |
| PubChem CID | 90080283 |
| Molecular Formula | C23H23F2N4O3S- |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 6-[2,5-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]-3-piperazin-1-ylquinoline |
| SMILES | O=C(c1ccc2ncc(N3CCNCC3)cc2c1)c1cc(F)cc(CCCNS(=O)[O-])c1F |
| InChI | InChI=1S/C23H24F2N4O3S/c24-18-11-15(2-1-5-28-33(31)32)22(25)20(13-18)23(30)16-3-4-21-17(10-16)12-19(14-27-21)29-8-6-26-7-9-29/h3-4,10-14,26,28H,1-2,5-9H2,(H,31,32)/p-1 |
| InChIKey | RCZUCLVGTADYDQ-UHFFFAOYSA-M |
| XLogP | 2.47 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 6-[2,5-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]-3-piperazin-1-ylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2,5-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]-3-piperazin-1-ylquinoline?
The IUPAC name of 6-[2,5-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]-3-piperazin-1-ylquinoline (CID 90080283) is 6-[2,5-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]-3-piperazin-1-ylquinoline.
What is the SMILES notation for 6-[2,5-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]-3-piperazin-1-ylquinoline?
The canonical SMILES for 6-[2,5-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]-3-piperazin-1-ylquinoline is O=C(c1ccc2ncc(N3CCNCC3)cc2c1)c1cc(F)cc(CCCNS(=O)[O-])c1F.
What is the InChIKey of 6-[2,5-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]-3-piperazin-1-ylquinoline?
The InChIKey is RCZUCLVGTADYDQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C23H24F2N4O3S/c24-18-11-15(2-1-5-28-33(31)32)22(25)20(13-18)23(30)16-3-4-21-17(10-16)12-19(14-27-21)29-8-6-26-7-9-29/h3-4,10-14,26,28H,1-2,5-9H2,(H,31,32)/p-1.
What are the key properties of 6-[2,5-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]-3-piperazin-1-ylquinoline?
6-[2,5-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]-3-piperazin-1-ylquinoline has a molecular weight of 473.53 g/mol, XLogP of 2.47, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2,5-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]-3-piperazin-1-ylquinoline is sourced from PubChem (CID 90080283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).