C15H12FNO — CID 90080295
9-fluoro-4-methyl-5,7-dihydrobenzo[d][1]benzazepin-6-one (PubChem CID 90080295) has the molecular formula C15H12FNO and a molecular weight of 241.27 g/mol. Its IUPAC name is 9-fluoro-4-methyl-5,7-dihydrobenzo[d][1]benzazepin-6-one.
| Compound Name | 9-fluoro-4-methyl-5,7-dihydrobenzo[d][1]benzazepin-6-one |
|---|---|
| PubChem CID | 90080295 |
| Molecular Formula | C15H12FNO |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 9-fluoro-4-methyl-5,7-dihydrobenzo[d][1]benzazepin-6-one |
| SMILES | Cc1cccc2c1NC(=O)Cc1cc(F)ccc1-2 |
| InChI | InChI=1S/C15H12FNO/c1-9-3-2-4-13-12-6-5-11(16)7-10(12)8-14(18)17-15(9)13/h2-7H,8H2,1H3,(H,17,18) |
| InChIKey | XQLAYZMQGXCCSF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |