About 9-fluoro-4-methyl-5,7-dihydrobenzo[d][1]benzazepin-6-one
9-fluoro-4-methyl-5,7-dihydrobenzo[d][1]benzazepin-6-one (PubChem CID 90080295) has the molecular formula C15H12FNO
and a molecular weight of 241.27 g/mol. Its IUPAC name is 9-fluoro-4-methyl-5,7-dihydrobenzo[d][1]benzazepin-6-one.
Molecular Properties
| Compound Name | 9-fluoro-4-methyl-5,7-dihydrobenzo[d][1]benzazepin-6-one |
| PubChem CID | 90080295 |
| Molecular Formula | C15H12FNO |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 9-fluoro-4-methyl-5,7-dihydrobenzo[d][1]benzazepin-6-one |
| SMILES | Cc1cccc2c1NC(=O)Cc1cc(F)ccc1-2 |
| InChI | InChI=1S/C15H12FNO/c1-9-3-2-4-13-12-6-5-11(16)7-10(12)8-14(18)17-15(9)13/h2-7H,8H2,1H3,(H,17,18) |
| InChIKey | XQLAYZMQGXCCSF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9-fluoro-4-methyl-5,7-dihydrobenzo[d][1]benzazepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-fluoro-4-methyl-5,7-dihydrobenzo[d][1]benzazepin-6-one?
The IUPAC name of 9-fluoro-4-methyl-5,7-dihydrobenzo[d][1]benzazepin-6-one (CID 90080295) is 9-fluoro-4-methyl-5,7-dihydrobenzo[d][1]benzazepin-6-one.
What is the SMILES notation for 9-fluoro-4-methyl-5,7-dihydrobenzo[d][1]benzazepin-6-one?
The canonical SMILES for 9-fluoro-4-methyl-5,7-dihydrobenzo[d][1]benzazepin-6-one is Cc1cccc2c1NC(=O)Cc1cc(F)ccc1-2.
What is the InChIKey of 9-fluoro-4-methyl-5,7-dihydrobenzo[d][1]benzazepin-6-one?
The InChIKey is XQLAYZMQGXCCSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12FNO/c1-9-3-2-4-13-12-6-5-11(16)7-10(12)8-14(18)17-15(9)13/h2-7H,8H2,1H3,(H,17,18).
What are the key properties of 9-fluoro-4-methyl-5,7-dihydrobenzo[d][1]benzazepin-6-one?
9-fluoro-4-methyl-5,7-dihydrobenzo[d][1]benzazepin-6-one has a molecular weight of 241.27 g/mol, XLogP of 3.30, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-fluoro-4-methyl-5,7-dihydrobenzo[d][1]benzazepin-6-one is sourced from PubChem (CID 90080295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).