About 6-[2-chloro-5,6-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]-3-cyanoquinoline
6-[2-chloro-5,6-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]-3-cyanoquinoline (PubChem CID 90080340) has the molecular formula C20H13ClF2N3O3S-
and a molecular weight of 448.86 g/mol. Its IUPAC name is 6-[2-chloro-5,6-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]-3-cyanoquinoline.
Molecular Properties
| Compound Name | 6-[2-chloro-5,6-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]-3-cyanoquinoline |
| PubChem CID | 90080340 |
| Molecular Formula | C20H13ClF2N3O3S- |
| Molecular Weight | 448.86 g/mol |
| Exact Mass | 448.03 |
| IUPAC Name | 6-[2-chloro-5,6-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]-3-cyanoquinoline |
| SMILES | N#Cc1cnc2ccc(C(=O)c3c(F)c(F)cc(CCCNS(=O)[O-])c3Cl)cc2c1 |
| InChI | InChI=1S/C20H14ClF2N3O3S/c21-18-12(2-1-5-26-30(28)29)8-15(22)19(23)17(18)20(27)13-3-4-16-14(7-13)6-11(9-24)10-25-16/h3-4,6-8,10,26H,1-2,5H2,(H,28,29)/p-1 |
| InChIKey | LNOYELYYAMZMLN-UHFFFAOYSA-M |
| XLogP | 3.59 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.86 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 6-[2-chloro-5,6-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]-3-cyanoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-chloro-5,6-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]-3-cyanoquinoline?
The IUPAC name of 6-[2-chloro-5,6-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]-3-cyanoquinoline (CID 90080340) is 6-[2-chloro-5,6-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]-3-cyanoquinoline.
What is the SMILES notation for 6-[2-chloro-5,6-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]-3-cyanoquinoline?
The canonical SMILES for 6-[2-chloro-5,6-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]-3-cyanoquinoline is N#Cc1cnc2ccc(C(=O)c3c(F)c(F)cc(CCCNS(=O)[O-])c3Cl)cc2c1.
What is the InChIKey of 6-[2-chloro-5,6-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]-3-cyanoquinoline?
The InChIKey is LNOYELYYAMZMLN-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H14ClF2N3O3S/c21-18-12(2-1-5-26-30(28)29)8-15(22)19(23)17(18)20(27)13-3-4-16-14(7-13)6-11(9-24)10-25-16/h3-4,6-8,10,26H,1-2,5H2,(H,28,29)/p-1.
What are the key properties of 6-[2-chloro-5,6-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]-3-cyanoquinoline?
6-[2-chloro-5,6-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]-3-cyanoquinoline has a molecular weight of 448.86 g/mol, XLogP of 3.59, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-chloro-5,6-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]-3-cyanoquinoline is sourced from PubChem (CID 90080340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).