About 3-(4-chlorophenyl)-6-[2,5-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]quinoline
3-(4-chlorophenyl)-6-[2,5-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]quinoline (PubChem CID 90080350) has the molecular formula C25H18ClF2N2O3S-
and a molecular weight of 499.95 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-6-[2,5-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]quinoline.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-6-[2,5-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]quinoline |
| PubChem CID | 90080350 |
| Molecular Formula | C25H18ClF2N2O3S- |
| Molecular Weight | 499.95 g/mol |
| Exact Mass | 499.07 |
| IUPAC Name | 3-(4-chlorophenyl)-6-[2,5-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]quinoline |
| SMILES | O=C(c1ccc2ncc(-c3ccc(Cl)cc3)cc2c1)c1cc(F)cc(CCCNS(=O)[O-])c1F |
| InChI | InChI=1S/C25H19ClF2N2O3S/c26-20-6-3-15(4-7-20)19-11-18-10-17(5-8-23(18)29-14-19)25(31)22-13-21(27)12-16(24(22)28)2-1-9-30-34(32)33/h3-8,10-14,30H,1-2,9H2,(H,32,33)/p-1 |
| InChIKey | MBGBEQXFMCAMHD-UHFFFAOYSA-M |
| XLogP | 5.38 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 499.95 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-chlorophenyl)-6-[2,5-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-6-[2,5-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]quinoline?
The IUPAC name of 3-(4-chlorophenyl)-6-[2,5-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]quinoline (CID 90080350) is 3-(4-chlorophenyl)-6-[2,5-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]quinoline.
What is the SMILES notation for 3-(4-chlorophenyl)-6-[2,5-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]quinoline?
The canonical SMILES for 3-(4-chlorophenyl)-6-[2,5-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]quinoline is O=C(c1ccc2ncc(-c3ccc(Cl)cc3)cc2c1)c1cc(F)cc(CCCNS(=O)[O-])c1F.
What is the InChIKey of 3-(4-chlorophenyl)-6-[2,5-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]quinoline?
The InChIKey is MBGBEQXFMCAMHD-UHFFFAOYSA-M. The full InChI is InChI=1S/C25H19ClF2N2O3S/c26-20-6-3-15(4-7-20)19-11-18-10-17(5-8-23(18)29-14-19)25(31)22-13-21(27)12-16(24(22)28)2-1-9-30-34(32)33/h3-8,10-14,30H,1-2,9H2,(H,32,33)/p-1.
What are the key properties of 3-(4-chlorophenyl)-6-[2,5-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]quinoline?
3-(4-chlorophenyl)-6-[2,5-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]quinoline has a molecular weight of 499.95 g/mol, XLogP of 5.38, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-6-[2,5-difluoro-3-[3-(sulfinatoamino)propyl]benzoyl]quinoline is sourced from PubChem (CID 90080350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).