About [5-(3,5-difluorophenyl)-2-(2,5-dioxopyrrolidin-1-yl)-4-hydroxyfuran-3-yl] acetate
[5-(3,5-difluorophenyl)-2-(2,5-dioxopyrrolidin-1-yl)-4-hydroxyfuran-3-yl] acetate (PubChem CID 90080375) has the molecular formula C16H11F2NO6
and a molecular weight of 351.26 g/mol. Its IUPAC name is [5-(3,5-difluorophenyl)-2-(2,5-dioxopyrrolidin-1-yl)-4-hydroxyfuran-3-yl] acetate.
Molecular Properties
| Compound Name | [5-(3,5-difluorophenyl)-2-(2,5-dioxopyrrolidin-1-yl)-4-hydroxyfuran-3-yl] acetate |
| PubChem CID | 90080375 |
| Molecular Formula | C16H11F2NO6 |
| Molecular Weight | 351.26 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | [5-(3,5-difluorophenyl)-2-(2,5-dioxopyrrolidin-1-yl)-4-hydroxyfuran-3-yl] acetate |
| SMILES | CC(=O)Oc1c(N2C(=O)CCC2=O)oc(-c2cc(F)cc(F)c2)c1O |
| InChI | InChI=1S/C16H11F2NO6/c1-7(20)24-15-13(23)14(8-4-9(17)6-10(18)5-8)25-16(15)19-11(21)2-3-12(19)22/h4-6,23H,2-3H2,1H3 |
| InChIKey | UWRRWWDFDDZICF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [5-(3,5-difluorophenyl)-2-(2,5-dioxopyrrolidin-1-yl)-4-hydroxyfuran-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(3,5-difluorophenyl)-2-(2,5-dioxopyrrolidin-1-yl)-4-hydroxyfuran-3-yl] acetate?
The IUPAC name of [5-(3,5-difluorophenyl)-2-(2,5-dioxopyrrolidin-1-yl)-4-hydroxyfuran-3-yl] acetate (CID 90080375) is [5-(3,5-difluorophenyl)-2-(2,5-dioxopyrrolidin-1-yl)-4-hydroxyfuran-3-yl] acetate.
What is the SMILES notation for [5-(3,5-difluorophenyl)-2-(2,5-dioxopyrrolidin-1-yl)-4-hydroxyfuran-3-yl] acetate?
The canonical SMILES for [5-(3,5-difluorophenyl)-2-(2,5-dioxopyrrolidin-1-yl)-4-hydroxyfuran-3-yl] acetate is CC(=O)Oc1c(N2C(=O)CCC2=O)oc(-c2cc(F)cc(F)c2)c1O.
What is the InChIKey of [5-(3,5-difluorophenyl)-2-(2,5-dioxopyrrolidin-1-yl)-4-hydroxyfuran-3-yl] acetate?
The InChIKey is UWRRWWDFDDZICF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11F2NO6/c1-7(20)24-15-13(23)14(8-4-9(17)6-10(18)5-8)25-16(15)19-11(21)2-3-12(19)22/h4-6,23H,2-3H2,1H3.
What are the key properties of [5-(3,5-difluorophenyl)-2-(2,5-dioxopyrrolidin-1-yl)-4-hydroxyfuran-3-yl] acetate?
[5-(3,5-difluorophenyl)-2-(2,5-dioxopyrrolidin-1-yl)-4-hydroxyfuran-3-yl] acetate has a molecular weight of 351.26 g/mol, XLogP of 2.51, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(3,5-difluorophenyl)-2-(2,5-dioxopyrrolidin-1-yl)-4-hydroxyfuran-3-yl] acetate is sourced from PubChem (CID 90080375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).