About N-[5-(3,5-difluorophenyl)-3,4-dihydroxyfuran-2-yl]ethanesulfonamide
N-[5-(3,5-difluorophenyl)-3,4-dihydroxyfuran-2-yl]ethanesulfonamide (PubChem CID 90080637) has the molecular formula C12H11F2NO5S
and a molecular weight of 319.29 g/mol. Its IUPAC name is N-[5-(3,5-difluorophenyl)-3,4-dihydroxyfuran-2-yl]ethanesulfonamide.
Molecular Properties
| Compound Name | N-[5-(3,5-difluorophenyl)-3,4-dihydroxyfuran-2-yl]ethanesulfonamide |
| PubChem CID | 90080637 |
| Molecular Formula | C12H11F2NO5S |
| Molecular Weight | 319.29 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | N-[5-(3,5-difluorophenyl)-3,4-dihydroxyfuran-2-yl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1oc(-c2cc(F)cc(F)c2)c(O)c1O |
| InChI | InChI=1S/C12H11F2NO5S/c1-2-21(18,19)15-12-10(17)9(16)11(20-12)6-3-7(13)5-8(14)4-6/h3-5,15-17H,2H2,1H3 |
| InChIKey | QJQBABSDYBJGDR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[5-(3,5-difluorophenyl)-3,4-dihydroxyfuran-2-yl]ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(3,5-difluorophenyl)-3,4-dihydroxyfuran-2-yl]ethanesulfonamide?
The IUPAC name of N-[5-(3,5-difluorophenyl)-3,4-dihydroxyfuran-2-yl]ethanesulfonamide (CID 90080637) is N-[5-(3,5-difluorophenyl)-3,4-dihydroxyfuran-2-yl]ethanesulfonamide.
What is the SMILES notation for N-[5-(3,5-difluorophenyl)-3,4-dihydroxyfuran-2-yl]ethanesulfonamide?
The canonical SMILES for N-[5-(3,5-difluorophenyl)-3,4-dihydroxyfuran-2-yl]ethanesulfonamide is CCS(=O)(=O)Nc1oc(-c2cc(F)cc(F)c2)c(O)c1O.
What is the InChIKey of N-[5-(3,5-difluorophenyl)-3,4-dihydroxyfuran-2-yl]ethanesulfonamide?
The InChIKey is QJQBABSDYBJGDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F2NO5S/c1-2-21(18,19)15-12-10(17)9(16)11(20-12)6-3-7(13)5-8(14)4-6/h3-5,15-17H,2H2,1H3.
What are the key properties of N-[5-(3,5-difluorophenyl)-3,4-dihydroxyfuran-2-yl]ethanesulfonamide?
N-[5-(3,5-difluorophenyl)-3,4-dihydroxyfuran-2-yl]ethanesulfonamide has a molecular weight of 319.29 g/mol, XLogP of 2.40, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(3,5-difluorophenyl)-3,4-dihydroxyfuran-2-yl]ethanesulfonamide is sourced from PubChem (CID 90080637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).