About [2-benzamido-5-(2,3-difluorophenyl)-4-hydroxyfuran-3-yl] acetate
[2-benzamido-5-(2,3-difluorophenyl)-4-hydroxyfuran-3-yl] acetate (PubChem CID 90080678) has the molecular formula C19H13F2NO5
and a molecular weight of 373.31 g/mol. Its IUPAC name is [2-benzamido-5-(2,3-difluorophenyl)-4-hydroxyfuran-3-yl] acetate.
Molecular Properties
| Compound Name | [2-benzamido-5-(2,3-difluorophenyl)-4-hydroxyfuran-3-yl] acetate |
| PubChem CID | 90080678 |
| Molecular Formula | C19H13F2NO5 |
| Molecular Weight | 373.31 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | [2-benzamido-5-(2,3-difluorophenyl)-4-hydroxyfuran-3-yl] acetate |
| SMILES | CC(=O)Oc1c(NC(=O)c2ccccc2)oc(-c2cccc(F)c2F)c1O |
| InChI | InChI=1S/C19H13F2NO5/c1-10(23)26-17-15(24)16(12-8-5-9-13(20)14(12)21)27-19(17)22-18(25)11-6-3-2-4-7-11/h2-9,24H,1H3,(H,22,25) |
| InChIKey | DJQXBQPNQCFWMF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.31 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-benzamido-5-(2,3-difluorophenyl)-4-hydroxyfuran-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-benzamido-5-(2,3-difluorophenyl)-4-hydroxyfuran-3-yl] acetate?
The IUPAC name of [2-benzamido-5-(2,3-difluorophenyl)-4-hydroxyfuran-3-yl] acetate (CID 90080678) is [2-benzamido-5-(2,3-difluorophenyl)-4-hydroxyfuran-3-yl] acetate.
What is the SMILES notation for [2-benzamido-5-(2,3-difluorophenyl)-4-hydroxyfuran-3-yl] acetate?
The canonical SMILES for [2-benzamido-5-(2,3-difluorophenyl)-4-hydroxyfuran-3-yl] acetate is CC(=O)Oc1c(NC(=O)c2ccccc2)oc(-c2cccc(F)c2F)c1O.
What is the InChIKey of [2-benzamido-5-(2,3-difluorophenyl)-4-hydroxyfuran-3-yl] acetate?
The InChIKey is DJQXBQPNQCFWMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13F2NO5/c1-10(23)26-17-15(24)16(12-8-5-9-13(20)14(12)21)27-19(17)22-18(25)11-6-3-2-4-7-11/h2-9,24H,1H3,(H,22,25).
What are the key properties of [2-benzamido-5-(2,3-difluorophenyl)-4-hydroxyfuran-3-yl] acetate?
[2-benzamido-5-(2,3-difluorophenyl)-4-hydroxyfuran-3-yl] acetate has a molecular weight of 373.31 g/mol, XLogP of 4.11, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-benzamido-5-(2,3-difluorophenyl)-4-hydroxyfuran-3-yl] acetate is sourced from PubChem (CID 90080678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).