About [2-acetamido-5-(3,5-difluorophenyl)-4-hydroxyfuran-3-yl] acetate
[2-acetamido-5-(3,5-difluorophenyl)-4-hydroxyfuran-3-yl] acetate (PubChem CID 90080723) has the molecular formula C14H11F2NO5
and a molecular weight of 311.24 g/mol. Its IUPAC name is [2-acetamido-5-(3,5-difluorophenyl)-4-hydroxyfuran-3-yl] acetate.
Molecular Properties
| Compound Name | [2-acetamido-5-(3,5-difluorophenyl)-4-hydroxyfuran-3-yl] acetate |
| PubChem CID | 90080723 |
| Molecular Formula | C14H11F2NO5 |
| Molecular Weight | 311.24 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | [2-acetamido-5-(3,5-difluorophenyl)-4-hydroxyfuran-3-yl] acetate |
| SMILES | CC(=O)Nc1oc(-c2cc(F)cc(F)c2)c(O)c1OC(C)=O |
| InChI | InChI=1S/C14H11F2NO5/c1-6(18)17-14-13(21-7(2)19)11(20)12(22-14)8-3-9(15)5-10(16)4-8/h3-5,20H,1-2H3,(H,17,18) |
| InChIKey | HRCRJRHLMKLYKW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.24 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-acetamido-5-(3,5-difluorophenyl)-4-hydroxyfuran-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-acetamido-5-(3,5-difluorophenyl)-4-hydroxyfuran-3-yl] acetate?
The IUPAC name of [2-acetamido-5-(3,5-difluorophenyl)-4-hydroxyfuran-3-yl] acetate (CID 90080723) is [2-acetamido-5-(3,5-difluorophenyl)-4-hydroxyfuran-3-yl] acetate.
What is the SMILES notation for [2-acetamido-5-(3,5-difluorophenyl)-4-hydroxyfuran-3-yl] acetate?
The canonical SMILES for [2-acetamido-5-(3,5-difluorophenyl)-4-hydroxyfuran-3-yl] acetate is CC(=O)Nc1oc(-c2cc(F)cc(F)c2)c(O)c1OC(C)=O.
What is the InChIKey of [2-acetamido-5-(3,5-difluorophenyl)-4-hydroxyfuran-3-yl] acetate?
The InChIKey is HRCRJRHLMKLYKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11F2NO5/c1-6(18)17-14-13(21-7(2)19)11(20)12(22-14)8-3-9(15)5-10(16)4-8/h3-5,20H,1-2H3,(H,17,18).
What are the key properties of [2-acetamido-5-(3,5-difluorophenyl)-4-hydroxyfuran-3-yl] acetate?
[2-acetamido-5-(3,5-difluorophenyl)-4-hydroxyfuran-3-yl] acetate has a molecular weight of 311.24 g/mol, XLogP of 2.81, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-acetamido-5-(3,5-difluorophenyl)-4-hydroxyfuran-3-yl] acetate is sourced from PubChem (CID 90080723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).