C14H9F2NO5 — CID 90080740
1-[5-(2,6-difluorophenyl)-3,4-dihydroxyfuran-2-yl]pyrrolidine-2,5-dione (PubChem CID 90080740) has the molecular formula C14H9F2NO5 and a molecular weight of 309.22 g/mol. Its IUPAC name is 1-[5-(2,6-difluorophenyl)-3,4-dihydroxyfuran-2-yl]pyrrolidine-2,5-dione.
| Compound Name | 1-[5-(2,6-difluorophenyl)-3,4-dihydroxyfuran-2-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 90080740 |
| Molecular Formula | C14H9F2NO5 |
| Molecular Weight | 309.22 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 1-[5-(2,6-difluorophenyl)-3,4-dihydroxyfuran-2-yl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1c1oc(-c2c(F)cccc2F)c(O)c1O |
| InChI | InChI=1S/C14H9F2NO5/c15-6-2-1-3-7(16)10(6)13-11(20)12(21)14(22-13)17-8(18)4-5-9(17)19/h1-3,20-21H,4-5H2 |
| InChIKey | SLVMZTWTCJGANW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.22 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|