About [5-(3,4-difluorophenyl)-2-(ethoxycarbonylamino)-4-hydroxyfuran-3-yl] acetate
[5-(3,4-difluorophenyl)-2-(ethoxycarbonylamino)-4-hydroxyfuran-3-yl] acetate (PubChem CID 90080863) has the molecular formula C15H13F2NO6
and a molecular weight of 341.27 g/mol. Its IUPAC name is [5-(3,4-difluorophenyl)-2-(ethoxycarbonylamino)-4-hydroxyfuran-3-yl] acetate.
Molecular Properties
| Compound Name | [5-(3,4-difluorophenyl)-2-(ethoxycarbonylamino)-4-hydroxyfuran-3-yl] acetate |
| PubChem CID | 90080863 |
| Molecular Formula | C15H13F2NO6 |
| Molecular Weight | 341.27 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | [5-(3,4-difluorophenyl)-2-(ethoxycarbonylamino)-4-hydroxyfuran-3-yl] acetate |
| SMILES | CCOC(=O)Nc1oc(-c2ccc(F)c(F)c2)c(O)c1OC(C)=O |
| InChI | InChI=1S/C15H13F2NO6/c1-3-22-15(21)18-14-13(23-7(2)19)11(20)12(24-14)8-4-5-9(16)10(17)6-8/h4-6,20H,3H2,1-2H3,(H,18,21) |
| InChIKey | MPJPSHPQRLPVAJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.27 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [5-(3,4-difluorophenyl)-2-(ethoxycarbonylamino)-4-hydroxyfuran-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(3,4-difluorophenyl)-2-(ethoxycarbonylamino)-4-hydroxyfuran-3-yl] acetate?
The IUPAC name of [5-(3,4-difluorophenyl)-2-(ethoxycarbonylamino)-4-hydroxyfuran-3-yl] acetate (CID 90080863) is [5-(3,4-difluorophenyl)-2-(ethoxycarbonylamino)-4-hydroxyfuran-3-yl] acetate.
What is the SMILES notation for [5-(3,4-difluorophenyl)-2-(ethoxycarbonylamino)-4-hydroxyfuran-3-yl] acetate?
The canonical SMILES for [5-(3,4-difluorophenyl)-2-(ethoxycarbonylamino)-4-hydroxyfuran-3-yl] acetate is CCOC(=O)Nc1oc(-c2ccc(F)c(F)c2)c(O)c1OC(C)=O.
What is the InChIKey of [5-(3,4-difluorophenyl)-2-(ethoxycarbonylamino)-4-hydroxyfuran-3-yl] acetate?
The InChIKey is MPJPSHPQRLPVAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F2NO6/c1-3-22-15(21)18-14-13(23-7(2)19)11(20)12(24-14)8-4-5-9(16)10(17)6-8/h4-6,20H,3H2,1-2H3,(H,18,21).
What are the key properties of [5-(3,4-difluorophenyl)-2-(ethoxycarbonylamino)-4-hydroxyfuran-3-yl] acetate?
[5-(3,4-difluorophenyl)-2-(ethoxycarbonylamino)-4-hydroxyfuran-3-yl] acetate has a molecular weight of 341.27 g/mol, XLogP of 3.42, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(3,4-difluorophenyl)-2-(ethoxycarbonylamino)-4-hydroxyfuran-3-yl] acetate is sourced from PubChem (CID 90080863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).