About 1-[5-(3,4-dimethoxyphenyl)-3,4-dihydroxyfuran-2-yl]pyrrolidin-2-one
1-[5-(3,4-dimethoxyphenyl)-3,4-dihydroxyfuran-2-yl]pyrrolidin-2-one (PubChem CID 90080933) has the molecular formula C16H17NO6
and a molecular weight of 319.31 g/mol. Its IUPAC name is 1-[5-(3,4-dimethoxyphenyl)-3,4-dihydroxyfuran-2-yl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-[5-(3,4-dimethoxyphenyl)-3,4-dihydroxyfuran-2-yl]pyrrolidin-2-one |
| PubChem CID | 90080933 |
| Molecular Formula | C16H17NO6 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 1-[5-(3,4-dimethoxyphenyl)-3,4-dihydroxyfuran-2-yl]pyrrolidin-2-one |
| SMILES | COc1ccc(-c2oc(N3CCCC3=O)c(O)c2O)cc1OC |
| InChI | InChI=1S/C16H17NO6/c1-21-10-6-5-9(8-11(10)22-2)15-13(19)14(20)16(23-15)17-7-3-4-12(17)18/h5-6,8,19-20H,3-4,7H2,1-2H3 |
| InChIKey | LVIWQBJEWIEVSM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[5-(3,4-dimethoxyphenyl)-3,4-dihydroxyfuran-2-yl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(3,4-dimethoxyphenyl)-3,4-dihydroxyfuran-2-yl]pyrrolidin-2-one?
The IUPAC name of 1-[5-(3,4-dimethoxyphenyl)-3,4-dihydroxyfuran-2-yl]pyrrolidin-2-one (CID 90080933) is 1-[5-(3,4-dimethoxyphenyl)-3,4-dihydroxyfuran-2-yl]pyrrolidin-2-one.
What is the SMILES notation for 1-[5-(3,4-dimethoxyphenyl)-3,4-dihydroxyfuran-2-yl]pyrrolidin-2-one?
The canonical SMILES for 1-[5-(3,4-dimethoxyphenyl)-3,4-dihydroxyfuran-2-yl]pyrrolidin-2-one is COc1ccc(-c2oc(N3CCCC3=O)c(O)c2O)cc1OC.
What is the InChIKey of 1-[5-(3,4-dimethoxyphenyl)-3,4-dihydroxyfuran-2-yl]pyrrolidin-2-one?
The InChIKey is LVIWQBJEWIEVSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO6/c1-21-10-6-5-9(8-11(10)22-2)15-13(19)14(20)16(23-15)17-7-3-4-12(17)18/h5-6,8,19-20H,3-4,7H2,1-2H3.
What are the key properties of 1-[5-(3,4-dimethoxyphenyl)-3,4-dihydroxyfuran-2-yl]pyrrolidin-2-one?
1-[5-(3,4-dimethoxyphenyl)-3,4-dihydroxyfuran-2-yl]pyrrolidin-2-one has a molecular weight of 319.31 g/mol, XLogP of 2.50, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(3,4-dimethoxyphenyl)-3,4-dihydroxyfuran-2-yl]pyrrolidin-2-one is sourced from PubChem (CID 90080933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).