About [2-(2,5-dioxopyrrolidin-1-yl)-4-hydroxy-5-(4-methoxyphenyl)furan-3-yl] acetate
[2-(2,5-dioxopyrrolidin-1-yl)-4-hydroxy-5-(4-methoxyphenyl)furan-3-yl] acetate (PubChem CID 90081245) has the molecular formula C17H15NO7
and a molecular weight of 345.31 g/mol. Its IUPAC name is [2-(2,5-dioxopyrrolidin-1-yl)-4-hydroxy-5-(4-methoxyphenyl)furan-3-yl] acetate.
Molecular Properties
| Compound Name | [2-(2,5-dioxopyrrolidin-1-yl)-4-hydroxy-5-(4-methoxyphenyl)furan-3-yl] acetate |
| PubChem CID | 90081245 |
| Molecular Formula | C17H15NO7 |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | [2-(2,5-dioxopyrrolidin-1-yl)-4-hydroxy-5-(4-methoxyphenyl)furan-3-yl] acetate |
| SMILES | COc1ccc(-c2oc(N3C(=O)CCC3=O)c(OC(C)=O)c2O)cc1 |
| InChI | InChI=1S/C17H15NO7/c1-9(19)24-16-14(22)15(10-3-5-11(23-2)6-4-10)25-17(16)18-12(20)7-8-13(18)21/h3-6,22H,7-8H2,1-2H3 |
| InChIKey | OHBANZZOSQIQOH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [2-(2,5-dioxopyrrolidin-1-yl)-4-hydroxy-5-(4-methoxyphenyl)furan-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,5-dioxopyrrolidin-1-yl)-4-hydroxy-5-(4-methoxyphenyl)furan-3-yl] acetate?
The IUPAC name of [2-(2,5-dioxopyrrolidin-1-yl)-4-hydroxy-5-(4-methoxyphenyl)furan-3-yl] acetate (CID 90081245) is [2-(2,5-dioxopyrrolidin-1-yl)-4-hydroxy-5-(4-methoxyphenyl)furan-3-yl] acetate.
What is the SMILES notation for [2-(2,5-dioxopyrrolidin-1-yl)-4-hydroxy-5-(4-methoxyphenyl)furan-3-yl] acetate?
The canonical SMILES for [2-(2,5-dioxopyrrolidin-1-yl)-4-hydroxy-5-(4-methoxyphenyl)furan-3-yl] acetate is COc1ccc(-c2oc(N3C(=O)CCC3=O)c(OC(C)=O)c2O)cc1.
What is the InChIKey of [2-(2,5-dioxopyrrolidin-1-yl)-4-hydroxy-5-(4-methoxyphenyl)furan-3-yl] acetate?
The InChIKey is OHBANZZOSQIQOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO7/c1-9(19)24-16-14(22)15(10-3-5-11(23-2)6-4-10)25-17(16)18-12(20)7-8-13(18)21/h3-6,22H,7-8H2,1-2H3.
What are the key properties of [2-(2,5-dioxopyrrolidin-1-yl)-4-hydroxy-5-(4-methoxyphenyl)furan-3-yl] acetate?
[2-(2,5-dioxopyrrolidin-1-yl)-4-hydroxy-5-(4-methoxyphenyl)furan-3-yl] acetate has a molecular weight of 345.31 g/mol, XLogP of 2.24, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,5-dioxopyrrolidin-1-yl)-4-hydroxy-5-(4-methoxyphenyl)furan-3-yl] acetate is sourced from PubChem (CID 90081245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).