About [5-(2,6-difluorophenyl)-2-[ethylsulfonyl(methyl)amino]-4-hydroxyfuran-3-yl] acetate
[5-(2,6-difluorophenyl)-2-[ethylsulfonyl(methyl)amino]-4-hydroxyfuran-3-yl] acetate (PubChem CID 90081671) has the molecular formula C15H15F2NO6S
and a molecular weight of 375.35 g/mol. Its IUPAC name is [5-(2,6-difluorophenyl)-2-[ethylsulfonyl(methyl)amino]-4-hydroxyfuran-3-yl] acetate.
Molecular Properties
| Compound Name | [5-(2,6-difluorophenyl)-2-[ethylsulfonyl(methyl)amino]-4-hydroxyfuran-3-yl] acetate |
| PubChem CID | 90081671 |
| Molecular Formula | C15H15F2NO6S |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | [5-(2,6-difluorophenyl)-2-[ethylsulfonyl(methyl)amino]-4-hydroxyfuran-3-yl] acetate |
| SMILES | CCS(=O)(=O)N(C)c1oc(-c2c(F)cccc2F)c(O)c1OC(C)=O |
| InChI | InChI=1S/C15H15F2NO6S/c1-4-25(21,22)18(3)15-14(23-8(2)19)12(20)13(24-15)11-9(16)6-5-7-10(11)17/h5-7,20H,4H2,1-3H3 |
| InChIKey | KLDCOIZRXFCWCU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [5-(2,6-difluorophenyl)-2-[ethylsulfonyl(methyl)amino]-4-hydroxyfuran-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2,6-difluorophenyl)-2-[ethylsulfonyl(methyl)amino]-4-hydroxyfuran-3-yl] acetate?
The IUPAC name of [5-(2,6-difluorophenyl)-2-[ethylsulfonyl(methyl)amino]-4-hydroxyfuran-3-yl] acetate (CID 90081671) is [5-(2,6-difluorophenyl)-2-[ethylsulfonyl(methyl)amino]-4-hydroxyfuran-3-yl] acetate.
What is the SMILES notation for [5-(2,6-difluorophenyl)-2-[ethylsulfonyl(methyl)amino]-4-hydroxyfuran-3-yl] acetate?
The canonical SMILES for [5-(2,6-difluorophenyl)-2-[ethylsulfonyl(methyl)amino]-4-hydroxyfuran-3-yl] acetate is CCS(=O)(=O)N(C)c1oc(-c2c(F)cccc2F)c(O)c1OC(C)=O.
What is the InChIKey of [5-(2,6-difluorophenyl)-2-[ethylsulfonyl(methyl)amino]-4-hydroxyfuran-3-yl] acetate?
The InChIKey is KLDCOIZRXFCWCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15F2NO6S/c1-4-25(21,22)18(3)15-14(23-8(2)19)12(20)13(24-15)11-9(16)6-5-7-10(11)17/h5-7,20H,4H2,1-3H3.
What are the key properties of [5-(2,6-difluorophenyl)-2-[ethylsulfonyl(methyl)amino]-4-hydroxyfuran-3-yl] acetate?
[5-(2,6-difluorophenyl)-2-[ethylsulfonyl(methyl)amino]-4-hydroxyfuran-3-yl] acetate has a molecular weight of 375.35 g/mol, XLogP of 2.64, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2,6-difluorophenyl)-2-[ethylsulfonyl(methyl)amino]-4-hydroxyfuran-3-yl] acetate is sourced from PubChem (CID 90081671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).