About ethyl N-[5-(2-fluorophenyl)-3,4-dihydroxyfuran-2-yl]carbamate
ethyl N-[5-(2-fluorophenyl)-3,4-dihydroxyfuran-2-yl]carbamate (PubChem CID 90081842) has the molecular formula C13H12FNO5
and a molecular weight of 281.24 g/mol. Its IUPAC name is ethyl N-[5-(2-fluorophenyl)-3,4-dihydroxyfuran-2-yl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[5-(2-fluorophenyl)-3,4-dihydroxyfuran-2-yl]carbamate |
| PubChem CID | 90081842 |
| Molecular Formula | C13H12FNO5 |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | ethyl N-[5-(2-fluorophenyl)-3,4-dihydroxyfuran-2-yl]carbamate |
| SMILES | CCOC(=O)Nc1oc(-c2ccccc2F)c(O)c1O |
| InChI | InChI=1S/C13H12FNO5/c1-2-19-13(18)15-12-10(17)9(16)11(20-12)7-5-3-4-6-8(7)14/h3-6,16-17H,2H2,1H3,(H,15,18) |
| InChIKey | CJOBJVJGGZFLCV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl N-[5-(2-fluorophenyl)-3,4-dihydroxyfuran-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[5-(2-fluorophenyl)-3,4-dihydroxyfuran-2-yl]carbamate?
The IUPAC name of ethyl N-[5-(2-fluorophenyl)-3,4-dihydroxyfuran-2-yl]carbamate (CID 90081842) is ethyl N-[5-(2-fluorophenyl)-3,4-dihydroxyfuran-2-yl]carbamate.
What is the SMILES notation for ethyl N-[5-(2-fluorophenyl)-3,4-dihydroxyfuran-2-yl]carbamate?
The canonical SMILES for ethyl N-[5-(2-fluorophenyl)-3,4-dihydroxyfuran-2-yl]carbamate is CCOC(=O)Nc1oc(-c2ccccc2F)c(O)c1O.
What is the InChIKey of ethyl N-[5-(2-fluorophenyl)-3,4-dihydroxyfuran-2-yl]carbamate?
The InChIKey is CJOBJVJGGZFLCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12FNO5/c1-2-19-13(18)15-12-10(17)9(16)11(20-12)7-5-3-4-6-8(7)14/h3-6,16-17H,2H2,1H3,(H,15,18).
What are the key properties of ethyl N-[5-(2-fluorophenyl)-3,4-dihydroxyfuran-2-yl]carbamate?
ethyl N-[5-(2-fluorophenyl)-3,4-dihydroxyfuran-2-yl]carbamate has a molecular weight of 281.24 g/mol, XLogP of 3.07, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[5-(2-fluorophenyl)-3,4-dihydroxyfuran-2-yl]carbamate is sourced from PubChem (CID 90081842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).