C8H18O3 — CID 90081952
ethane-1,2-diol;3-methoxypent-1-ene (PubChem CID 90081952) has the molecular formula C8H18O3 and a molecular weight of 162.23 g/mol. Its IUPAC name is ethane-1,2-diol;3-methoxypent-1-ene.
| Compound Name | ethane-1,2-diol;3-methoxypent-1-ene |
|---|---|
| PubChem CID | 90081952 |
| Molecular Formula | C8H18O3 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.13 |
| IUPAC Name | ethane-1,2-diol;3-methoxypent-1-ene |
| SMILES | C=CC(CC)OC.OCCO |
| InChI | InChI=1S/C6H12O.C2H6O2/c1-4-6(5-2)7-3;3-1-2-4/h4,6H,1,5H2,2-3H3;3-4H,1-2H2 |
| InChIKey | PBYMFALJHLVURL-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|