About 5-amino-2-(2,3-dichlorophenyl)-2-methyl-4-trimethylsilyloxyfuran-3-one
5-amino-2-(2,3-dichlorophenyl)-2-methyl-4-trimethylsilyloxyfuran-3-one (PubChem CID 90082115) has the molecular formula C14H17Cl2NO3Si
and a molecular weight of 346.29 g/mol. Its IUPAC name is 5-amino-2-(2,3-dichlorophenyl)-2-methyl-4-trimethylsilyloxyfuran-3-one.
Molecular Properties
| Compound Name | 5-amino-2-(2,3-dichlorophenyl)-2-methyl-4-trimethylsilyloxyfuran-3-one |
| PubChem CID | 90082115 |
| Molecular Formula | C14H17Cl2NO3Si |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 5-amino-2-(2,3-dichlorophenyl)-2-methyl-4-trimethylsilyloxyfuran-3-one |
| SMILES | CC1(c2cccc(Cl)c2Cl)OC(N)=C(O[Si](C)(C)C)C1=O |
| InChI | InChI=1S/C14H17Cl2NO3Si/c1-14(8-6-5-7-9(15)10(8)16)12(18)11(13(17)19-14)20-21(2,3)4/h5-7H,17H2,1-4H3 |
| InChIKey | SDLUYEAYWUSXLS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2-(2,3-dichlorophenyl)-2-methyl-4-trimethylsilyloxyfuran-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-(2,3-dichlorophenyl)-2-methyl-4-trimethylsilyloxyfuran-3-one?
The IUPAC name of 5-amino-2-(2,3-dichlorophenyl)-2-methyl-4-trimethylsilyloxyfuran-3-one (CID 90082115) is 5-amino-2-(2,3-dichlorophenyl)-2-methyl-4-trimethylsilyloxyfuran-3-one.
What is the SMILES notation for 5-amino-2-(2,3-dichlorophenyl)-2-methyl-4-trimethylsilyloxyfuran-3-one?
The canonical SMILES for 5-amino-2-(2,3-dichlorophenyl)-2-methyl-4-trimethylsilyloxyfuran-3-one is CC1(c2cccc(Cl)c2Cl)OC(N)=C(O[Si](C)(C)C)C1=O.
What is the InChIKey of 5-amino-2-(2,3-dichlorophenyl)-2-methyl-4-trimethylsilyloxyfuran-3-one?
The InChIKey is SDLUYEAYWUSXLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17Cl2NO3Si/c1-14(8-6-5-7-9(15)10(8)16)12(18)11(13(17)19-14)20-21(2,3)4/h5-7H,17H2,1-4H3.
What are the key properties of 5-amino-2-(2,3-dichlorophenyl)-2-methyl-4-trimethylsilyloxyfuran-3-one?
5-amino-2-(2,3-dichlorophenyl)-2-methyl-4-trimethylsilyloxyfuran-3-one has a molecular weight of 346.29 g/mol, XLogP of 3.79, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-(2,3-dichlorophenyl)-2-methyl-4-trimethylsilyloxyfuran-3-one is sourced from PubChem (CID 90082115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).