C30H29ClN4O4S — CID 90082708
N-(benzenesulfonyl)-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(2-methylpyrazol-3-yl)-1H-indole-2-carboxamide (PubChem CID 90082708) has the molecular formula C30H29ClN4O4S and a molecular weight of 577.11 g/mol. Its IUPAC name is N-(benzenesulfonyl)-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(2-methylpyrazol-3-yl)-1H-indole-2-carboxamide.
| Compound Name | N-(benzenesulfonyl)-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(2-methylpyrazol-3-yl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 90082708 |
| Molecular Formula | C30H29ClN4O4S |
| Molecular Weight | 577.11 g/mol |
| Exact Mass | 576.16 |
| IUPAC Name | N-(benzenesulfonyl)-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(2-methylpyrazol-3-yl)-1H-indole-2-carboxamide |
| SMILES | Cc1cc(OCCCc2c(C(=O)NS(=O)(=O)c3ccccc3)[nH]c3c(-c4ccnn4C)cccc23)cc(C)c1Cl |
| InChI | InChI=1S/C30H29ClN4O4S/c1-19-17-21(18-20(2)27(19)31)39-16-8-13-24-23-11-7-12-25(26-14-15-32-35(26)3)28(23)33-29(24)30(36)34-40(37,38)22-9-5-4-6-10-22/h4-7,9-12,14-15,17-18,33H,8,13,16H2,1-3H3,(H,34,36) |
| InChIKey | JDDSLDSOYSXYIX-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.11 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|