C15H26NO4+ — CID 90082808
(3S)-2-tert-butyl-3-ethyl-1,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-ium-2,3-dicarboxylic acid (PubChem CID 90082808) has the molecular formula C15H26NO4+ and a molecular weight of 284.38 g/mol. Its IUPAC name is (3S)-2-tert-butyl-3-ethyl-1,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-ium-2,3-dicarboxylic acid.
| Compound Name | (3S)-2-tert-butyl-3-ethyl-1,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-ium-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 90082808 |
| Molecular Formula | C15H26NO4+ |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | (3S)-2-tert-butyl-3-ethyl-1,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-ium-2,3-dicarboxylic acid |
| SMILES | CC[C@@]1(C(=O)O)C2CCCC2C[N+]1(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C15H25NO4/c1-5-15(12(17)18)11-8-6-7-10(11)9-16(15,13(19)20)14(2,3)4/h10-11H,5-9H2,1-4H3,(H-,17,18,19,20)/p+1/t10?,11?,15-,16?/m0/s1 |
| InChIKey | GDWIKFKMIPLZHT-SQGCJCFSSA-O |
| XLogP | 2.94 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|