C26H28ClN3O4 — CID 90083023
3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[3-(hydroxymethyl)-1,5-dimethylpyrazol-4-yl]-1H-indole-2-carboxylic acid (PubChem CID 90083023) has the molecular formula C26H28ClN3O4 and a molecular weight of 481.98 g/mol. Its IUPAC name is 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[3-(hydroxymethyl)-1,5-dimethylpyrazol-4-yl]-1H-indole-2-carboxylic acid.
| Compound Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[3-(hydroxymethyl)-1,5-dimethylpyrazol-4-yl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 90083023 |
| Molecular Formula | C26H28ClN3O4 |
| Molecular Weight | 481.98 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[3-(hydroxymethyl)-1,5-dimethylpyrazol-4-yl]-1H-indole-2-carboxylic acid |
| SMILES | Cc1cc(OCCCc2c(C(=O)O)[nH]c3c(-c4c(CO)nn(C)c4C)cccc23)cc(C)c1Cl |
| InChI | InChI=1S/C26H28ClN3O4/c1-14-11-17(12-15(2)23(14)27)34-10-6-9-19-18-7-5-8-20(24(18)28-25(19)26(32)33)22-16(3)30(4)29-21(22)13-31/h5,7-8,11-12,28,31H,6,9-10,13H2,1-4H3,(H,32,33) |
| InChIKey | RESZVAIBIVOLKN-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 100.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.98 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|