C30H37ClN4O4 — CID 90083070
3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[3-[2-(dimethylamino)ethoxymethyl]-1,5-dimethylpyrazol-4-yl]-1H-indole-2-carboxylic acid (PubChem CID 90083070) has the molecular formula C30H37ClN4O4 and a molecular weight of 553.10 g/mol. Its IUPAC name is 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[3-[2-(dimethylamino)ethoxymethyl]-1,5-dimethylpyrazol-4-yl]-1H-indole-2-carboxylic acid.
| Compound Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[3-[2-(dimethylamino)ethoxymethyl]-1,5-dimethylpyrazol-4-yl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 90083070 |
| Molecular Formula | C30H37ClN4O4 |
| Molecular Weight | 553.10 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[3-[2-(dimethylamino)ethoxymethyl]-1,5-dimethylpyrazol-4-yl]-1H-indole-2-carboxylic acid |
| SMILES | Cc1cc(OCCCc2c(C(=O)O)[nH]c3c(-c4c(COCCN(C)C)nn(C)c4C)cccc23)cc(C)c1Cl |
| InChI | InChI=1S/C30H37ClN4O4/c1-18-15-21(16-19(2)27(18)31)39-13-8-11-23-22-9-7-10-24(28(22)32-29(23)30(36)37)26-20(3)35(6)33-25(26)17-38-14-12-34(4)5/h7,9-10,15-16,32H,8,11-14,17H2,1-6H3,(H,36,37) |
| InChIKey | RJTYTRDTYIOSFA-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 92.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.10 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|