C15H18F3NO2 — CID 90083096
1-(4-benzyl-1,3-oxazolidin-3-yl)-5,5,5-trifluoropentan-1-one (PubChem CID 90083096) has the molecular formula C15H18F3NO2 and a molecular weight of 301.31 g/mol. Its IUPAC name is 1-(4-benzyl-1,3-oxazolidin-3-yl)-5,5,5-trifluoropentan-1-one.
| Compound Name | 1-(4-benzyl-1,3-oxazolidin-3-yl)-5,5,5-trifluoropentan-1-one |
|---|---|
| PubChem CID | 90083096 |
| Molecular Formula | C15H18F3NO2 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 1-(4-benzyl-1,3-oxazolidin-3-yl)-5,5,5-trifluoropentan-1-one |
| SMILES | O=C(CCCC(F)(F)F)N1COCC1Cc1ccccc1 |
| InChI | InChI=1S/C15H18F3NO2/c16-15(17,18)8-4-7-14(20)19-11-21-10-13(19)9-12-5-2-1-3-6-12/h1-3,5-6,13H,4,7-11H2 |
| InChIKey | KOZPYGYJYMMRSJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |