C30H25F5N4O4 — CID 90083193
(2R,3R)-3-[[1-(3-cyanophenyl)-6-(difluoromethyl)-4-oxo-3,5-dihydro-2H-1,5-benzodiazepin-3-yl]carbamoyl]-6,6,6-trifluoro-2-phenylhexanoic acid (PubChem CID 90083193) has the molecular formula C30H25F5N4O4 and a molecular weight of 600.54 g/mol. Its IUPAC name is (2R,3R)-3-[[1-(3-cyanophenyl)-6-(difluoromethyl)-4-oxo-3,5-dihydro-2H-1,5-benzodiazepin-3-yl]carbamoyl]-6,6,6-trifluoro-2-phenylhexanoic acid.
| Compound Name | (2R,3R)-3-[[1-(3-cyanophenyl)-6-(difluoromethyl)-4-oxo-3,5-dihydro-2H-1,5-benzodiazepin-3-yl]carbamoyl]-6,6,6-trifluoro-2-phenylhexanoic acid |
|---|---|
| PubChem CID | 90083193 |
| Molecular Formula | C30H25F5N4O4 |
| Molecular Weight | 600.54 g/mol |
| Exact Mass | 600.18 |
| IUPAC Name | (2R,3R)-3-[[1-(3-cyanophenyl)-6-(difluoromethyl)-4-oxo-3,5-dihydro-2H-1,5-benzodiazepin-3-yl]carbamoyl]-6,6,6-trifluoro-2-phenylhexanoic acid |
| SMILES | N#Cc1cccc(N2CC(NC(=O)[C@H](CCC(F)(F)F)[C@@H](C(=O)O)c3ccccc3)C(=O)Nc3c(C(F)F)cccc32)c1 |
| InChI | InChI=1S/C30H25F5N4O4/c31-26(32)21-10-5-11-23-25(21)38-28(41)22(16-39(23)19-9-4-6-17(14-19)15-36)37-27(40)20(12-13-30(33,34)35)24(29(42)43)18-7-2-1-3-8-18/h1-11,14,20,22,24,26H,12-13,16H2,(H,37,40)(H,38,41)(H,42,43)/t20-,22?,24+/m1/s1 |
| InChIKey | XBDRZTPWIPQFSC-KTAMEUSZSA-N |
| XLogP | 5.90 |
| TPSA | 122.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.54 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |