C29H29ClF3N3O4 — CID 90083276
(2S,3R)-3-[[(3S)-5-(4-chlorophenyl)-9-cyclopropyl-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamoyl]-2-(cyclopropylmethyl)-6,6,6-trifluorohexanoic acid (PubChem CID 90083276) has the molecular formula C29H29ClF3N3O4 and a molecular weight of 576.02 g/mol. Its IUPAC name is (2S,3R)-3-[[(3S)-5-(4-chlorophenyl)-9-cyclopropyl-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamoyl]-2-(cyclopropylmethyl)-6,6,6-trifluorohexanoic acid.
| Compound Name | (2S,3R)-3-[[(3S)-5-(4-chlorophenyl)-9-cyclopropyl-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamoyl]-2-(cyclopropylmethyl)-6,6,6-trifluorohexanoic acid |
|---|---|
| PubChem CID | 90083276 |
| Molecular Formula | C29H29ClF3N3O4 |
| Molecular Weight | 576.02 g/mol |
| Exact Mass | 575.18 |
| IUPAC Name | (2S,3R)-3-[[(3S)-5-(4-chlorophenyl)-9-cyclopropyl-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamoyl]-2-(cyclopropylmethyl)-6,6,6-trifluorohexanoic acid |
| SMILES | O=C1Nc2c(cccc2C2CC2)C(c2ccc(Cl)cc2)=N[C@@H]1NC(=O)[C@H](CCC(F)(F)F)[C@H](CC1CC1)C(=O)O |
| InChI | InChI=1S/C29H29ClF3N3O4/c30-18-10-8-17(9-11-18)23-21-3-1-2-19(16-6-7-16)24(21)35-27(38)25(34-23)36-26(37)20(12-13-29(31,32)33)22(28(39)40)14-15-4-5-15/h1-3,8-11,15-16,20,22,25H,4-7,12-14H2,(H,35,38)(H,36,37)(H,39,40)/t20-,22+,25-/m1/s1 |
| InChIKey | WELYTRJGNKBANT-JLRUASKGSA-N |
| XLogP | 5.91 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.02 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |