About (1E,3Z)-N-methyl-1-sulfanylpenta-1,3-diene-2-sulfonamide
(1E,3Z)-N-methyl-1-sulfanylpenta-1,3-diene-2-sulfonamide (PubChem CID 90083527) has the molecular formula C6H11NO2S2
and a molecular weight of 193.29 g/mol. Its IUPAC name is (1E,3Z)-N-methyl-1-sulfanylpenta-1,3-diene-2-sulfonamide.
Molecular Properties
| Compound Name | (1E,3Z)-N-methyl-1-sulfanylpenta-1,3-diene-2-sulfonamide |
| PubChem CID | 90083527 |
| Molecular Formula | C6H11NO2S2 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.02 |
| IUPAC Name | (1E,3Z)-N-methyl-1-sulfanylpenta-1,3-diene-2-sulfonamide |
| SMILES | C/C=C\C(=C/S)S(=O)(=O)NC |
| InChI | InChI=1S/C6H11NO2S2/c1-3-4-6(5-10)11(8,9)7-2/h3-5,7,10H,1-2H3/b4-3-,6-5+ |
| InChIKey | JREIQQHAZZFHLS-DNVGVPOPSA-N |
| XLogP | 0.88 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (1E,3Z)-N-methyl-1-sulfanylpenta-1,3-diene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E,3Z)-N-methyl-1-sulfanylpenta-1,3-diene-2-sulfonamide?
The IUPAC name of (1E,3Z)-N-methyl-1-sulfanylpenta-1,3-diene-2-sulfonamide (CID 90083527) is (1E,3Z)-N-methyl-1-sulfanylpenta-1,3-diene-2-sulfonamide.
What is the SMILES notation for (1E,3Z)-N-methyl-1-sulfanylpenta-1,3-diene-2-sulfonamide?
The canonical SMILES for (1E,3Z)-N-methyl-1-sulfanylpenta-1,3-diene-2-sulfonamide is C/C=C\C(=C/S)S(=O)(=O)NC.
What is the InChIKey of (1E,3Z)-N-methyl-1-sulfanylpenta-1,3-diene-2-sulfonamide?
The InChIKey is JREIQQHAZZFHLS-DNVGVPOPSA-N. The full InChI is InChI=1S/C6H11NO2S2/c1-3-4-6(5-10)11(8,9)7-2/h3-5,7,10H,1-2H3/b4-3-,6-5+.
What are the key properties of (1E,3Z)-N-methyl-1-sulfanylpenta-1,3-diene-2-sulfonamide?
(1E,3Z)-N-methyl-1-sulfanylpenta-1,3-diene-2-sulfonamide has a molecular weight of 193.29 g/mol, XLogP of 0.88, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1E,3Z)-N-methyl-1-sulfanylpenta-1,3-diene-2-sulfonamide is sourced from PubChem (CID 90083527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).