About 5-fluoro-3-prop-2-enyl-1,4-benzodiazepin-2-one
5-fluoro-3-prop-2-enyl-1,4-benzodiazepin-2-one (PubChem CID 90083620) has the molecular formula C12H9FN2O
and a molecular weight of 216.21 g/mol. Its IUPAC name is 5-fluoro-3-prop-2-enyl-1,4-benzodiazepin-2-one.
Molecular Properties
| Compound Name | 5-fluoro-3-prop-2-enyl-1,4-benzodiazepin-2-one |
| PubChem CID | 90083620 |
| Molecular Formula | C12H9FN2O |
| Molecular Weight | 216.21 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 5-fluoro-3-prop-2-enyl-1,4-benzodiazepin-2-one |
| SMILES | C=CCc1nc(F)c2ccccc2nc1=O |
| InChI | InChI=1S/C12H9FN2O/c1-2-5-10-12(16)15-9-7-4-3-6-8(9)11(13)14-10/h2-4,6-7H,1,5H2 |
| InChIKey | XMTPSBJAGMGJJZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.21 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-3-prop-2-enyl-1,4-benzodiazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-3-prop-2-enyl-1,4-benzodiazepin-2-one?
The IUPAC name of 5-fluoro-3-prop-2-enyl-1,4-benzodiazepin-2-one (CID 90083620) is 5-fluoro-3-prop-2-enyl-1,4-benzodiazepin-2-one.
What is the SMILES notation for 5-fluoro-3-prop-2-enyl-1,4-benzodiazepin-2-one?
The canonical SMILES for 5-fluoro-3-prop-2-enyl-1,4-benzodiazepin-2-one is C=CCc1nc(F)c2ccccc2nc1=O.
What is the InChIKey of 5-fluoro-3-prop-2-enyl-1,4-benzodiazepin-2-one?
The InChIKey is XMTPSBJAGMGJJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9FN2O/c1-2-5-10-12(16)15-9-7-4-3-6-8(9)11(13)14-10/h2-4,6-7H,1,5H2.
What are the key properties of 5-fluoro-3-prop-2-enyl-1,4-benzodiazepin-2-one?
5-fluoro-3-prop-2-enyl-1,4-benzodiazepin-2-one has a molecular weight of 216.21 g/mol, XLogP of 1.86, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-3-prop-2-enyl-1,4-benzodiazepin-2-one is sourced from PubChem (CID 90083620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).