About 2-[3-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)propoxy]ethanamine
2-[3-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)propoxy]ethanamine (PubChem CID 90083729) has the molecular formula C11H21NO4
and a molecular weight of 231.29 g/mol. Its IUPAC name is 2-[3-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)propoxy]ethanamine.
Molecular Properties
| Compound Name | 2-[3-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)propoxy]ethanamine |
| PubChem CID | 90083729 |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 2-[3-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)propoxy]ethanamine |
| SMILES | CC12COC(CCCOCCN)(OC1)OC2 |
| InChI | InChI=1S/C11H21NO4/c1-10-7-14-11(15-8-10,16-9-10)3-2-5-13-6-4-12/h2-9,12H2,1H3 |
| InChIKey | FNGOLSIDATWPRJ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)propoxy]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)propoxy]ethanamine?
The IUPAC name of 2-[3-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)propoxy]ethanamine (CID 90083729) is 2-[3-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)propoxy]ethanamine.
What is the SMILES notation for 2-[3-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)propoxy]ethanamine?
The canonical SMILES for 2-[3-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)propoxy]ethanamine is CC12COC(CCCOCCN)(OC1)OC2.
What is the InChIKey of 2-[3-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)propoxy]ethanamine?
The InChIKey is FNGOLSIDATWPRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO4/c1-10-7-14-11(15-8-10,16-9-10)3-2-5-13-6-4-12/h2-9,12H2,1H3.
What are the key properties of 2-[3-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)propoxy]ethanamine?
2-[3-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)propoxy]ethanamine has a molecular weight of 231.29 g/mol, XLogP of 0.48, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)propoxy]ethanamine is sourced from PubChem (CID 90083729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).