C20H26O5 — CID 90084191
(1R,8R,9S,11R,12S)-8-ethyl-12-hydroxy-11-methyl-6-methylidene-16-oxo-15-oxatetracyclo[9.3.2.01,10.02,8]hexadec-13-ene-9-carboxylic acid (PubChem CID 90084191) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is (1R,8R,9S,11R,12S)-8-ethyl-12-hydroxy-11-methyl-6-methylidene-16-oxo-15-oxatetracyclo[9.3.2.01,10.02,8]hexadec-13-ene-9-carboxylic acid.
| Compound Name | (1R,8R,9S,11R,12S)-8-ethyl-12-hydroxy-11-methyl-6-methylidene-16-oxo-15-oxatetracyclo[9.3.2.01,10.02,8]hexadec-13-ene-9-carboxylic acid |
|---|---|
| PubChem CID | 90084191 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (1R,8R,9S,11R,12S)-8-ethyl-12-hydroxy-11-methyl-6-methylidene-16-oxo-15-oxatetracyclo[9.3.2.01,10.02,8]hexadec-13-ene-9-carboxylic acid |
| SMILES | C=C1CCCC2[C@@](CC)(C1)C(C(=O)O)C1[C@@]23C=C[C@H](O)[C@]1(C)C(=O)O3 |
| InChI | InChI=1S/C20H26O5/c1-4-19-10-11(2)6-5-7-12(19)20-9-8-13(21)18(3,17(24)25-20)15(20)14(19)16(22)23/h8-9,12-15,21H,2,4-7,10H2,1,3H3,(H,22,23)/t12?,13-,14?,15?,18-,19+,20+/m0/s1 |
| InChIKey | DMDACEHKNQXNEO-GKIOCLTFSA-N |
| XLogP | 2.69 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|