C10H14F6N2 — CID 90084221
N'-ethyl-2,2,2-trifluoro-N-[(E)-1,1,1-trifluoro-3-methylpent-2-en-2-yl]ethanimidamide (PubChem CID 90084221) has the molecular formula C10H14F6N2 and a molecular weight of 276.22 g/mol. Its IUPAC name is N'-ethyl-2,2,2-trifluoro-N-[(E)-1,1,1-trifluoro-3-methylpent-2-en-2-yl]ethanimidamide.
| Compound Name | N'-ethyl-2,2,2-trifluoro-N-[(E)-1,1,1-trifluoro-3-methylpent-2-en-2-yl]ethanimidamide |
|---|---|
| PubChem CID | 90084221 |
| Molecular Formula | C10H14F6N2 |
| Molecular Weight | 276.22 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | N'-ethyl-2,2,2-trifluoro-N-[(E)-1,1,1-trifluoro-3-methylpent-2-en-2-yl]ethanimidamide |
| SMILES | CC/N=C(/N/C(=C(\C)CC)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H14F6N2/c1-4-6(3)7(9(11,12)13)18-8(17-5-2)10(14,15)16/h4-5H2,1-3H3,(H,17,18)/b7-6+ |
| InChIKey | SIBRGDLKCMEXFB-VOTSOKGWSA-N |
| XLogP | 3.80 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.22 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|