About [4-(3-oxoprop-1-en-2-yl)cyclohexyl]methyl 2-methylprop-2-enoate
[4-(3-oxoprop-1-en-2-yl)cyclohexyl]methyl 2-methylprop-2-enoate (PubChem CID 90084258) has the molecular formula C14H20O3
and a molecular weight of 236.31 g/mol. Its IUPAC name is [4-(3-oxoprop-1-en-2-yl)cyclohexyl]methyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | [4-(3-oxoprop-1-en-2-yl)cyclohexyl]methyl 2-methylprop-2-enoate |
| PubChem CID | 90084258 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | [4-(3-oxoprop-1-en-2-yl)cyclohexyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1CCC(C(=C)C=O)CC1 |
| InChI | InChI=1S/C14H20O3/c1-10(2)14(16)17-9-12-4-6-13(7-5-12)11(3)8-15/h8,12-13H,1,3-7,9H2,2H3 |
| InChIKey | ZJLUOFGHVMTLGE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [4-(3-oxoprop-1-en-2-yl)cyclohexyl]methyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3-oxoprop-1-en-2-yl)cyclohexyl]methyl 2-methylprop-2-enoate?
The IUPAC name of [4-(3-oxoprop-1-en-2-yl)cyclohexyl]methyl 2-methylprop-2-enoate (CID 90084258) is [4-(3-oxoprop-1-en-2-yl)cyclohexyl]methyl 2-methylprop-2-enoate.
What is the SMILES notation for [4-(3-oxoprop-1-en-2-yl)cyclohexyl]methyl 2-methylprop-2-enoate?
The canonical SMILES for [4-(3-oxoprop-1-en-2-yl)cyclohexyl]methyl 2-methylprop-2-enoate is C=C(C)C(=O)OCC1CCC(C(=C)C=O)CC1.
What is the InChIKey of [4-(3-oxoprop-1-en-2-yl)cyclohexyl]methyl 2-methylprop-2-enoate?
The InChIKey is ZJLUOFGHVMTLGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O3/c1-10(2)14(16)17-9-12-4-6-13(7-5-12)11(3)8-15/h8,12-13H,1,3-7,9H2,2H3.
What are the key properties of [4-(3-oxoprop-1-en-2-yl)cyclohexyl]methyl 2-methylprop-2-enoate?
[4-(3-oxoprop-1-en-2-yl)cyclohexyl]methyl 2-methylprop-2-enoate has a molecular weight of 236.31 g/mol, XLogP of 2.67, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3-oxoprop-1-en-2-yl)cyclohexyl]methyl 2-methylprop-2-enoate is sourced from PubChem (CID 90084258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).