About 3-hydrazinyl-4-methylcyclopenta-1,2,4-trien-1-amine
3-hydrazinyl-4-methylcyclopenta-1,2,4-trien-1-amine (PubChem CID 90084262) has the molecular formula C6H9N3
and a molecular weight of 123.16 g/mol. Its IUPAC name is 3-hydrazinyl-4-methylcyclopenta-1,2,4-trien-1-amine.
Molecular Properties
| Compound Name | 3-hydrazinyl-4-methylcyclopenta-1,2,4-trien-1-amine |
| PubChem CID | 90084262 |
| Molecular Formula | C6H9N3 |
| Molecular Weight | 123.16 g/mol |
| Exact Mass | 123.08 |
| IUPAC Name | 3-hydrazinyl-4-methylcyclopenta-1,2,4-trien-1-amine |
| SMILES | CC1=CC(N)=C=C1NN |
| InChI | InChI=1S/C6H9N3/c1-4-2-5(7)3-6(4)9-8/h2,9H,7-8H2,1H3 |
| InChIKey | YTSPIWCZBBNLHP-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.16 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-hydrazinyl-4-methylcyclopenta-1,2,4-trien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydrazinyl-4-methylcyclopenta-1,2,4-trien-1-amine?
The IUPAC name of 3-hydrazinyl-4-methylcyclopenta-1,2,4-trien-1-amine (CID 90084262) is 3-hydrazinyl-4-methylcyclopenta-1,2,4-trien-1-amine.
What is the SMILES notation for 3-hydrazinyl-4-methylcyclopenta-1,2,4-trien-1-amine?
The canonical SMILES for 3-hydrazinyl-4-methylcyclopenta-1,2,4-trien-1-amine is CC1=CC(N)=C=C1NN.
What is the InChIKey of 3-hydrazinyl-4-methylcyclopenta-1,2,4-trien-1-amine?
The InChIKey is YTSPIWCZBBNLHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3/c1-4-2-5(7)3-6(4)9-8/h2,9H,7-8H2,1H3.
What are the key properties of 3-hydrazinyl-4-methylcyclopenta-1,2,4-trien-1-amine?
3-hydrazinyl-4-methylcyclopenta-1,2,4-trien-1-amine has a molecular weight of 123.16 g/mol, XLogP of -0.26, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydrazinyl-4-methylcyclopenta-1,2,4-trien-1-amine is sourced from PubChem (CID 90084262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).