C20H34N4OSi — CID 90084296
dimethyl-[2-[[6-(4-methylpiperazin-1-yl)benzimidazol-1-yl]methoxy]ethyl]-propan-2-ylsilane (PubChem CID 90084296) has the molecular formula C20H34N4OSi and a molecular weight of 374.61 g/mol. Its IUPAC name is dimethyl-[2-[[6-(4-methylpiperazin-1-yl)benzimidazol-1-yl]methoxy]ethyl]-propan-2-ylsilane.
| Compound Name | dimethyl-[2-[[6-(4-methylpiperazin-1-yl)benzimidazol-1-yl]methoxy]ethyl]-propan-2-ylsilane |
|---|---|
| PubChem CID | 90084296 |
| Molecular Formula | C20H34N4OSi |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | dimethyl-[2-[[6-(4-methylpiperazin-1-yl)benzimidazol-1-yl]methoxy]ethyl]-propan-2-ylsilane |
| SMILES | CC(C)[Si](C)(C)CCOCn1cnc2ccc(N3CCN(C)CC3)cc21 |
| InChI | InChI=1S/C20H34N4OSi/c1-17(2)26(4,5)13-12-25-16-24-15-21-19-7-6-18(14-20(19)24)23-10-8-22(3)9-11-23/h6-7,14-15,17H,8-13,16H2,1-5H3 |
| InChIKey | IAGVJJNPSKBPBW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|