C20H17ClNO3+ — CID 90084380
14-chloro-16-methoxy-17-methyl-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene (PubChem CID 90084380) has the molecular formula C20H17ClNO3+ and a molecular weight of 354.81 g/mol. Its IUPAC name is 14-chloro-16-methoxy-17-methyl-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene.
| Compound Name | 14-chloro-16-methoxy-17-methyl-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene |
|---|---|
| PubChem CID | 90084380 |
| Molecular Formula | C20H17ClNO3+ |
| Molecular Weight | 354.81 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 14-chloro-16-methoxy-17-methyl-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene |
| SMILES | COc1c(C)ccc2cc3[n+](c(Cl)c12)CCc1cc2c(cc1-3)OCO2 |
| InChI | InChI=1S/C20H17ClNO3/c1-11-3-4-13-7-15-14-9-17-16(24-10-25-17)8-12(14)5-6-22(15)20(21)18(13)19(11)23-2/h3-4,7-9H,5-6,10H2,1-2H3/q+1 |
| InChIKey | JJUUDQWSCSFAOU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 31.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.81 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|