C24H28O2 — CID 90084407
(5E,17E)-5,17-dimethyl-2,14-dioxatricyclo[18.4.0.08,13]tetracosa-1(24),5,8,10,12,17,20,22-octaene (PubChem CID 90084407) has the molecular formula C24H28O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is (5E,17E)-5,17-dimethyl-2,14-dioxatricyclo[18.4.0.08,13]tetracosa-1(24),5,8,10,12,17,20,22-octaene.
| Compound Name | (5E,17E)-5,17-dimethyl-2,14-dioxatricyclo[18.4.0.08,13]tetracosa-1(24),5,8,10,12,17,20,22-octaene |
|---|---|
| PubChem CID | 90084407 |
| Molecular Formula | C24H28O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | (5E,17E)-5,17-dimethyl-2,14-dioxatricyclo[18.4.0.08,13]tetracosa-1(24),5,8,10,12,17,20,22-octaene |
| SMILES | C/C1=C\Cc2ccccc2OCC/C(C)=C/Cc2ccccc2OCC1 |
| InChI | InChI=1S/C24H28O2/c1-19-11-13-21-7-3-5-9-23(21)26-18-16-20(2)12-14-22-8-4-6-10-24(22)25-17-15-19/h3-12H,13-18H2,1-2H3/b19-11+,20-12+ |
| InChIKey | BPIOOVRCEHJJFI-AYKLPDECSA-N |
| XLogP | 5.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|