About pent-4-enyl (2S)-1-hept-6-enoylpyrrolidine-2-carboxylate
pent-4-enyl (2S)-1-hept-6-enoylpyrrolidine-2-carboxylate (PubChem CID 90084422) has the molecular formula C17H27NO3
and a molecular weight of 293.41 g/mol. Its IUPAC name is pent-4-enyl (2S)-1-hept-6-enoylpyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | pent-4-enyl (2S)-1-hept-6-enoylpyrrolidine-2-carboxylate |
| PubChem CID | 90084422 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | pent-4-enyl (2S)-1-hept-6-enoylpyrrolidine-2-carboxylate |
| SMILES | C=CCCCCC(=O)N1CCC[C@H]1C(=O)OCCCC=C |
| InChI | InChI=1S/C17H27NO3/c1-3-5-7-8-12-16(19)18-13-10-11-15(18)17(20)21-14-9-6-4-2/h3-4,15H,1-2,5-14H2/t15-/m0/s1 |
| InChIKey | YARAOONBEDRMTH-HNNXBMFYSA-N |
| XLogP | 3.23 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze pent-4-enyl (2S)-1-hept-6-enoylpyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pent-4-enyl (2S)-1-hept-6-enoylpyrrolidine-2-carboxylate?
The IUPAC name of pent-4-enyl (2S)-1-hept-6-enoylpyrrolidine-2-carboxylate (CID 90084422) is pent-4-enyl (2S)-1-hept-6-enoylpyrrolidine-2-carboxylate.
What is the SMILES notation for pent-4-enyl (2S)-1-hept-6-enoylpyrrolidine-2-carboxylate?
The canonical SMILES for pent-4-enyl (2S)-1-hept-6-enoylpyrrolidine-2-carboxylate is C=CCCCCC(=O)N1CCC[C@H]1C(=O)OCCCC=C.
What is the InChIKey of pent-4-enyl (2S)-1-hept-6-enoylpyrrolidine-2-carboxylate?
The InChIKey is YARAOONBEDRMTH-HNNXBMFYSA-N. The full InChI is InChI=1S/C17H27NO3/c1-3-5-7-8-12-16(19)18-13-10-11-15(18)17(20)21-14-9-6-4-2/h3-4,15H,1-2,5-14H2/t15-/m0/s1.
What are the key properties of pent-4-enyl (2S)-1-hept-6-enoylpyrrolidine-2-carboxylate?
pent-4-enyl (2S)-1-hept-6-enoylpyrrolidine-2-carboxylate has a molecular weight of 293.41 g/mol, XLogP of 3.23, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pent-4-enyl (2S)-1-hept-6-enoylpyrrolidine-2-carboxylate is sourced from PubChem (CID 90084422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).