C16H24O2 — CID 90084480
1-[2-(buta-1,3-dien-2-yloxymethyl)butoxy]cyclohepta-1,3-diene (PubChem CID 90084480) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-[2-(buta-1,3-dien-2-yloxymethyl)butoxy]cyclohepta-1,3-diene.
| Compound Name | 1-[2-(buta-1,3-dien-2-yloxymethyl)butoxy]cyclohepta-1,3-diene |
|---|---|
| PubChem CID | 90084480 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 1-[2-(buta-1,3-dien-2-yloxymethyl)butoxy]cyclohepta-1,3-diene |
| SMILES | C=CC(=C)OCC(CC)COC1=CC=CCCC1 |
| InChI | InChI=1S/C16H24O2/c1-4-14(3)17-12-15(5-2)13-18-16-10-8-6-7-9-11-16/h4,6,8,10,15H,1,3,5,7,9,11-13H2,2H3 |
| InChIKey | KXYKQZDJOSDXQA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|