About 1-chloro-3-(3-methylcyclohexa-1,5-dien-1-yl)propan-2-one
1-chloro-3-(3-methylcyclohexa-1,5-dien-1-yl)propan-2-one (PubChem CID 90084583) has the molecular formula C10H13ClO
and a molecular weight of 184.67 g/mol. Its IUPAC name is 1-chloro-3-(3-methylcyclohexa-1,5-dien-1-yl)propan-2-one.
Molecular Properties
| Compound Name | 1-chloro-3-(3-methylcyclohexa-1,5-dien-1-yl)propan-2-one |
| PubChem CID | 90084583 |
| Molecular Formula | C10H13ClO |
| Molecular Weight | 184.67 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 1-chloro-3-(3-methylcyclohexa-1,5-dien-1-yl)propan-2-one |
| SMILES | CC1C=C(CC(=O)CCl)C=CC1 |
| InChI | InChI=1S/C10H13ClO/c1-8-3-2-4-9(5-8)6-10(12)7-11/h2,4-5,8H,3,6-7H2,1H3 |
| InChIKey | JRSIGVYIBPEXQA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.67 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-3-(3-methylcyclohexa-1,5-dien-1-yl)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-(3-methylcyclohexa-1,5-dien-1-yl)propan-2-one?
The IUPAC name of 1-chloro-3-(3-methylcyclohexa-1,5-dien-1-yl)propan-2-one (CID 90084583) is 1-chloro-3-(3-methylcyclohexa-1,5-dien-1-yl)propan-2-one.
What is the SMILES notation for 1-chloro-3-(3-methylcyclohexa-1,5-dien-1-yl)propan-2-one?
The canonical SMILES for 1-chloro-3-(3-methylcyclohexa-1,5-dien-1-yl)propan-2-one is CC1C=C(CC(=O)CCl)C=CC1.
What is the InChIKey of 1-chloro-3-(3-methylcyclohexa-1,5-dien-1-yl)propan-2-one?
The InChIKey is JRSIGVYIBPEXQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClO/c1-8-3-2-4-9(5-8)6-10(12)7-11/h2,4-5,8H,3,6-7H2,1H3.
What are the key properties of 1-chloro-3-(3-methylcyclohexa-1,5-dien-1-yl)propan-2-one?
1-chloro-3-(3-methylcyclohexa-1,5-dien-1-yl)propan-2-one has a molecular weight of 184.67 g/mol, XLogP of 2.71, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-(3-methylcyclohexa-1,5-dien-1-yl)propan-2-one is sourced from PubChem (CID 90084583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).