About 2-[cyanomethyl(methyl)amino]-2-(3-methylcyclohexa-1,5-dien-1-yl)acetonitrile
2-[cyanomethyl(methyl)amino]-2-(3-methylcyclohexa-1,5-dien-1-yl)acetonitrile (PubChem CID 90084593) has the molecular formula C12H15N3
and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-[cyanomethyl(methyl)amino]-2-(3-methylcyclohexa-1,5-dien-1-yl)acetonitrile.
Molecular Properties
| Compound Name | 2-[cyanomethyl(methyl)amino]-2-(3-methylcyclohexa-1,5-dien-1-yl)acetonitrile |
| PubChem CID | 90084593 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 2-[cyanomethyl(methyl)amino]-2-(3-methylcyclohexa-1,5-dien-1-yl)acetonitrile |
| SMILES | CC1C=C(C(C#N)N(C)CC#N)C=CC1 |
| InChI | InChI=1S/C12H15N3/c1-10-4-3-5-11(8-10)12(9-14)15(2)7-6-13/h3,5,8,10,12H,4,7H2,1-2H3 |
| InChIKey | SNYSGZMJURIHSJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze 2-[cyanomethyl(methyl)amino]-2-(3-methylcyclohexa-1,5-dien-1-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[cyanomethyl(methyl)amino]-2-(3-methylcyclohexa-1,5-dien-1-yl)acetonitrile?
The IUPAC name of 2-[cyanomethyl(methyl)amino]-2-(3-methylcyclohexa-1,5-dien-1-yl)acetonitrile (CID 90084593) is 2-[cyanomethyl(methyl)amino]-2-(3-methylcyclohexa-1,5-dien-1-yl)acetonitrile.
What is the SMILES notation for 2-[cyanomethyl(methyl)amino]-2-(3-methylcyclohexa-1,5-dien-1-yl)acetonitrile?
The canonical SMILES for 2-[cyanomethyl(methyl)amino]-2-(3-methylcyclohexa-1,5-dien-1-yl)acetonitrile is CC1C=C(C(C#N)N(C)CC#N)C=CC1.
What is the InChIKey of 2-[cyanomethyl(methyl)amino]-2-(3-methylcyclohexa-1,5-dien-1-yl)acetonitrile?
The InChIKey is SNYSGZMJURIHSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3/c1-10-4-3-5-11(8-10)12(9-14)15(2)7-6-13/h3,5,8,10,12H,4,7H2,1-2H3.
What are the key properties of 2-[cyanomethyl(methyl)amino]-2-(3-methylcyclohexa-1,5-dien-1-yl)acetonitrile?
2-[cyanomethyl(methyl)amino]-2-(3-methylcyclohexa-1,5-dien-1-yl)acetonitrile has a molecular weight of 201.27 g/mol, XLogP of 1.86, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[cyanomethyl(methyl)amino]-2-(3-methylcyclohexa-1,5-dien-1-yl)acetonitrile is sourced from PubChem (CID 90084593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).