About 2,6-bis(3,5-difluoro-2-pyridinyl)-3,5-difluoropyridine
2,6-bis(3,5-difluoro-2-pyridinyl)-3,5-difluoropyridine (PubChem CID 90084661) has the molecular formula C15H5F6N3
and a molecular weight of 341.21 g/mol. Its IUPAC name is 2,6-bis(3,5-difluoro-2-pyridinyl)-3,5-difluoropyridine.
Molecular Properties
| Compound Name | 2,6-bis(3,5-difluoro-2-pyridinyl)-3,5-difluoropyridine |
| PubChem CID | 90084661 |
| Molecular Formula | C15H5F6N3 |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 2,6-bis(3,5-difluoro-2-pyridinyl)-3,5-difluoropyridine |
| SMILES | Fc1cnc(-c2nc(-c3ncc(F)cc3F)c(F)cc2F)c(F)c1 |
| InChI | InChI=1S/C15H5F6N3/c16-6-1-8(18)12(22-4-6)14-10(20)3-11(21)15(24-14)13-9(19)2-7(17)5-23-13/h1-5H |
| InChIKey | BMJNVTLPJMKIGG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,6-bis(3,5-difluoro-2-pyridinyl)-3,5-difluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis(3,5-difluoro-2-pyridinyl)-3,5-difluoropyridine?
The IUPAC name of 2,6-bis(3,5-difluoro-2-pyridinyl)-3,5-difluoropyridine (CID 90084661) is 2,6-bis(3,5-difluoro-2-pyridinyl)-3,5-difluoropyridine.
What is the SMILES notation for 2,6-bis(3,5-difluoro-2-pyridinyl)-3,5-difluoropyridine?
The canonical SMILES for 2,6-bis(3,5-difluoro-2-pyridinyl)-3,5-difluoropyridine is Fc1cnc(-c2nc(-c3ncc(F)cc3F)c(F)cc2F)c(F)c1.
What is the InChIKey of 2,6-bis(3,5-difluoro-2-pyridinyl)-3,5-difluoropyridine?
The InChIKey is BMJNVTLPJMKIGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H5F6N3/c16-6-1-8(18)12(22-4-6)14-10(20)3-11(21)15(24-14)13-9(19)2-7(17)5-23-13/h1-5H.
What are the key properties of 2,6-bis(3,5-difluoro-2-pyridinyl)-3,5-difluoropyridine?
2,6-bis(3,5-difluoro-2-pyridinyl)-3,5-difluoropyridine has a molecular weight of 341.21 g/mol, XLogP of 4.04, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis(3,5-difluoro-2-pyridinyl)-3,5-difluoropyridine is sourced from PubChem (CID 90084661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).