About 6-(5,6-difluoro-2-pyridinyl)-2,3-difluoropyridine
6-(5,6-difluoro-2-pyridinyl)-2,3-difluoropyridine (PubChem CID 90084670) has the molecular formula C10H4F4N2
and a molecular weight of 228.15 g/mol. Its IUPAC name is 6-(5,6-difluoro-2-pyridinyl)-2,3-difluoropyridine.
Molecular Properties
| Compound Name | 6-(5,6-difluoro-2-pyridinyl)-2,3-difluoropyridine |
| PubChem CID | 90084670 |
| Molecular Formula | C10H4F4N2 |
| Molecular Weight | 228.15 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | 6-(5,6-difluoro-2-pyridinyl)-2,3-difluoropyridine |
| SMILES | Fc1ccc(-c2ccc(F)c(F)n2)nc1F |
| InChI | InChI=1S/C10H4F4N2/c11-5-1-3-7(15-9(5)13)8-4-2-6(12)10(14)16-8/h1-4H |
| InChIKey | QDELAAUCBFBRCQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.15 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-(5,6-difluoro-2-pyridinyl)-2,3-difluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(5,6-difluoro-2-pyridinyl)-2,3-difluoropyridine?
The IUPAC name of 6-(5,6-difluoro-2-pyridinyl)-2,3-difluoropyridine (CID 90084670) is 6-(5,6-difluoro-2-pyridinyl)-2,3-difluoropyridine.
What is the SMILES notation for 6-(5,6-difluoro-2-pyridinyl)-2,3-difluoropyridine?
The canonical SMILES for 6-(5,6-difluoro-2-pyridinyl)-2,3-difluoropyridine is Fc1ccc(-c2ccc(F)c(F)n2)nc1F.
What is the InChIKey of 6-(5,6-difluoro-2-pyridinyl)-2,3-difluoropyridine?
The InChIKey is QDELAAUCBFBRCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H4F4N2/c11-5-1-3-7(15-9(5)13)8-4-2-6(12)10(14)16-8/h1-4H.
What are the key properties of 6-(5,6-difluoro-2-pyridinyl)-2,3-difluoropyridine?
6-(5,6-difluoro-2-pyridinyl)-2,3-difluoropyridine has a molecular weight of 228.15 g/mol, XLogP of 2.70, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(5,6-difluoro-2-pyridinyl)-2,3-difluoropyridine is sourced from PubChem (CID 90084670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).