C21H20N2O3 — CID 90084739
[(2R,5S)-7-benzylspiro[7,8-diazabicyclo[4.2.0]oct-1(6)-ene-5,2'-oxirane]-2-yl] benzoate (PubChem CID 90084739) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is [(2R,5S)-7-benzylspiro[7,8-diazabicyclo[4.2.0]oct-1(6)-ene-5,2'-oxirane]-2-yl] benzoate.
| Compound Name | [(2R,5S)-7-benzylspiro[7,8-diazabicyclo[4.2.0]oct-1(6)-ene-5,2'-oxirane]-2-yl] benzoate |
|---|---|
| PubChem CID | 90084739 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | [(2R,5S)-7-benzylspiro[7,8-diazabicyclo[4.2.0]oct-1(6)-ene-5,2'-oxirane]-2-yl] benzoate |
| SMILES | O=C(O[C@@H]1CC[C@@]2(CO2)c2c1[nH]n2Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H20N2O3/c24-20(16-9-5-2-6-10-16)26-17-11-12-21(14-25-21)19-18(17)22-23(19)13-15-7-3-1-4-8-15/h1-10,17,22H,11-14H2/t17-,21-/m1/s1 |
| InChIKey | FBGCGIRFSCUIGJ-DYESRHJHSA-N |
| XLogP | 3.78 |
| TPSA | 59.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|