C15H25NO5 — CID 90084850
5-O-tert-butyl 4-O-methyl (3aR,4S,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrole-4,5-dicarboxylate (PubChem CID 90084850) has the molecular formula C15H25NO5 and a molecular weight of 299.37 g/mol. Its IUPAC name is 5-O-tert-butyl 4-O-methyl (3aR,4S,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrole-4,5-dicarboxylate.
| Compound Name | 5-O-tert-butyl 4-O-methyl (3aR,4S,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 90084850 |
| Molecular Formula | C15H25NO5 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 5-O-tert-butyl 4-O-methyl (3aR,4S,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrole-4,5-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2CC(C)(C)O[C@H]2CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25NO5/c1-14(2,3)21-13(18)16-8-10-9(7-15(4,5)20-10)11(16)12(17)19-6/h9-11H,7-8H2,1-6H3/t9-,10-,11-/m0/s1 |
| InChIKey | WDRALZTZVCGBQW-DCAQKATOSA-N |
| XLogP | 1.96 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |