C20H24FIN6O2 — CID 90085112
9-[2-(2,2-dimethylpropylamino)ethyl]-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-6-amine (PubChem CID 90085112) has the molecular formula C20H24FIN6O2 and a molecular weight of 526.35 g/mol. Its IUPAC name is 9-[2-(2,2-dimethylpropylamino)ethyl]-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-6-amine.
| Compound Name | 9-[2-(2,2-dimethylpropylamino)ethyl]-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-6-amine |
|---|---|
| PubChem CID | 90085112 |
| Molecular Formula | C20H24FIN6O2 |
| Molecular Weight | 526.35 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | 9-[2-(2,2-dimethylpropylamino)ethyl]-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-6-amine |
| SMILES | CC(C)(C)CNCCn1c(Cc2cc3c(cc2I)OCO3)nc2c(N)nc(F)nc21 |
| InChI | InChI=1S/C20H24FIN6O2/c1-20(2,3)9-24-4-5-28-15(25-16-17(23)26-19(21)27-18(16)28)7-11-6-13-14(8-12(11)22)30-10-29-13/h6,8,24H,4-5,7,9-10H2,1-3H3,(H2,23,26,27) |
| InChIKey | AIERKFGCPMBFOR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|