C42H42B2N2O4 — CID 90085357
5,12-bis[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indolo[3,2-c]carbazole (PubChem CID 90085357) has the molecular formula C42H42B2N2O4 and a molecular weight of 660.43 g/mol. Its IUPAC name is 5,12-bis[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indolo[3,2-c]carbazole.
| Compound Name | 5,12-bis[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indolo[3,2-c]carbazole |
|---|---|
| PubChem CID | 90085357 |
| Molecular Formula | C42H42B2N2O4 |
| Molecular Weight | 660.43 g/mol |
| Exact Mass | 660.33 |
| IUPAC Name | 5,12-bis[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indolo[3,2-c]carbazole |
| SMILES | CC1(C)OB(c2cccc(-n3c4ccccc4c4c3ccc3c5ccccc5n(-c5cccc(B6OC(C)(C)C(C)(C)O6)c5)c34)c2)OC1(C)C |
| InChI | InChI=1S/C42H42B2N2O4/c1-39(2)40(3,4)48-43(47-39)27-15-13-17-29(25-27)45-35-22-12-10-20-33(35)37-36(45)24-23-32-31-19-9-11-21-34(31)46(38(32)37)30-18-14-16-28(26-30)44-49-41(5,6)42(7,8)50-44/h9-26H,1-8H3 |
| InChIKey | ADCBGMXKGUZXDU-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 46.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.43 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|