C32H33ClN4O5S — CID 90085790
3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[2-[(1-methylindole-3-carbonyl)amino]ethylsulfonyl]-1H-indole-2-carboxamide (PubChem CID 90085790) has the molecular formula C32H33ClN4O5S and a molecular weight of 621.16 g/mol. Its IUPAC name is 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[2-[(1-methylindole-3-carbonyl)amino]ethylsulfonyl]-1H-indole-2-carboxamide.
| Compound Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[2-[(1-methylindole-3-carbonyl)amino]ethylsulfonyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 90085790 |
| Molecular Formula | C32H33ClN4O5S |
| Molecular Weight | 621.16 g/mol |
| Exact Mass | 620.19 |
| IUPAC Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[2-[(1-methylindole-3-carbonyl)amino]ethylsulfonyl]-1H-indole-2-carboxamide |
| SMILES | Cc1cc(OCCCc2c(C(=O)NS(=O)(=O)CCNC(=O)c3cn(C)c4ccccc34)[nH]c3ccccc23)cc(C)c1Cl |
| InChI | InChI=1S/C32H33ClN4O5S/c1-20-17-22(18-21(2)29(20)33)42-15-8-11-25-23-9-4-6-12-27(23)35-30(25)32(39)36-43(40,41)16-14-34-31(38)26-19-37(3)28-13-7-5-10-24(26)28/h4-7,9-10,12-13,17-19,35H,8,11,14-16H2,1-3H3,(H,34,38)(H,36,39) |
| InChIKey | GUKNVQSEBBJHKI-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.16 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|