C17H14ClF6N5O — CID 90086212
5-chloro-6-[2,6-difluoro-4-(3-fluoropropoxy)phenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 90086212) has the molecular formula C17H14ClF6N5O and a molecular weight of 453.77 g/mol. Its IUPAC name is 5-chloro-6-[2,6-difluoro-4-(3-fluoropropoxy)phenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-chloro-6-[2,6-difluoro-4-(3-fluoropropoxy)phenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 90086212 |
| Molecular Formula | C17H14ClF6N5O |
| Molecular Weight | 453.77 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | 5-chloro-6-[2,6-difluoro-4-(3-fluoropropoxy)phenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C[C@H](Nc1c(-c2c(F)cc(OCCCF)cc2F)c(Cl)nc2ncnn12)C(F)(F)F |
| InChI | InChI=1S/C17H14ClF6N5O/c1-8(17(22,23)24)27-15-13(14(18)28-16-25-7-26-29(15)16)12-10(20)5-9(6-11(12)21)30-4-2-3-19/h5-8,27H,2-4H2,1H3/t8-/m0/s1 |
| InChIKey | JXMIMJPTFCQEBD-QMMMGPOBSA-N |
| XLogP | 4.82 |
| TPSA | 64.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.77 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|