C13H23NO4 — CID 90086532
(3R,3aR,6S,6aR)-3a,6a-dimethyl-6-piperidin-4-yloxy-2,3,5,6-tetrahydrofuro[3,2-b]furan-3-ol (PubChem CID 90086532) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is (3R,3aR,6S,6aR)-3a,6a-dimethyl-6-piperidin-4-yloxy-2,3,5,6-tetrahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6S,6aR)-3a,6a-dimethyl-6-piperidin-4-yloxy-2,3,5,6-tetrahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 90086532 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | (3R,3aR,6S,6aR)-3a,6a-dimethyl-6-piperidin-4-yloxy-2,3,5,6-tetrahydrofuro[3,2-b]furan-3-ol |
| SMILES | C[C@]12OC[C@H](OC3CCNCC3)[C@@]1(C)OC[C@H]2O |
| InChI | InChI=1S/C13H23NO4/c1-12-10(15)7-16-13(12,2)11(8-17-12)18-9-3-5-14-6-4-9/h9-11,14-15H,3-8H2,1-2H3/t10-,11+,12-,13-/m1/s1 |
| InChIKey | ZFAFJMBMOJAFIE-YVECIDJPSA-N |
| XLogP | 0.06 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |