C46H53ClO5Si — CID 90086857
tert-butyl-[[2-chloro-5-[(3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]-3-methoxyphenyl]methoxy]-diphenylsilane (PubChem CID 90086857) has the molecular formula C46H53ClO5Si and a molecular weight of 749.46 g/mol. Its IUPAC name is tert-butyl-[[2-chloro-5-[(3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]-3-methoxyphenyl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[2-chloro-5-[(3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]-3-methoxyphenyl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 90086857 |
| Molecular Formula | C46H53ClO5Si |
| Molecular Weight | 749.46 g/mol |
| Exact Mass | 748.34 |
| IUPAC Name | tert-butyl-[[2-chloro-5-[(3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]-3-methoxyphenyl]methoxy]-diphenylsilane |
| SMILES | CC[C@H]1OC(c2cc(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)c(Cl)c(OC)c2)C(OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C46H53ClO5Si/c1-7-40-33(2)43(49-30-34-20-12-8-13-21-34)45(50-31-35-22-14-9-15-23-35)44(52-40)36-28-37(42(47)41(29-36)48-6)32-51-53(46(3,4)5,38-24-16-10-17-25-38)39-26-18-11-19-27-39/h8-29,33,40,43-45H,7,30-32H2,1-6H3/t33-,40-,43+,44?,45?/m1/s1 |
| InChIKey | AWKBFLSZDMWDIQ-PVYNEIIZSA-N |
| XLogP | 10.08 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.46 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|