C17H21F5O — CID 90087107
(2S,5R)-2-(2,2-dimethylpropyl)-5-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]oxolane (PubChem CID 90087107) has the molecular formula C17H21F5O and a molecular weight of 336.34 g/mol. Its IUPAC name is (2S,5R)-2-(2,2-dimethylpropyl)-5-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]oxolane.
| Compound Name | (2S,5R)-2-(2,2-dimethylpropyl)-5-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]oxolane |
|---|---|
| PubChem CID | 90087107 |
| Molecular Formula | C17H21F5O |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (2S,5R)-2-(2,2-dimethylpropyl)-5-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]oxolane |
| SMILES | CC(C)(C)C[C@@H]1CC[C@H](c2ccc(C(F)(F)C(F)(F)F)cc2)O1 |
| InChI | InChI=1S/C17H21F5O/c1-15(2,3)10-13-8-9-14(23-13)11-4-6-12(7-5-11)16(18,19)17(20,21)22/h4-7,13-14H,8-10H2,1-3H3/t13-,14+/m0/s1 |
| InChIKey | VIXOPLJBPBQWIY-UONOGXRCSA-N |
| XLogP | 6.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|