C16H30O5 — CID 90087897
(3R,4S,5R)-2-[(4S)-4,8-dimethylnon-7-enoxy]oxane-3,4,5-triol (PubChem CID 90087897) has the molecular formula C16H30O5 and a molecular weight of 302.41 g/mol. Its IUPAC name is (3R,4S,5R)-2-[(4S)-4,8-dimethylnon-7-enoxy]oxane-3,4,5-triol.
| Compound Name | (3R,4S,5R)-2-[(4S)-4,8-dimethylnon-7-enoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 90087897 |
| Molecular Formula | C16H30O5 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | (3R,4S,5R)-2-[(4S)-4,8-dimethylnon-7-enoxy]oxane-3,4,5-triol |
| SMILES | CC(C)=CCC[C@H](C)CCCOC1OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H30O5/c1-11(2)6-4-7-12(3)8-5-9-20-16-15(19)14(18)13(17)10-21-16/h6,12-19H,4-5,7-10H2,1-3H3/t12-,13+,14-,15+,16?/m0/s1 |
| InChIKey | PZHWKPIIKNTISI-JPIQDLEPSA-N |
| XLogP | 1.60 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|